C32H44O4 — CID 169050148
2,6-ditert-butyl-1,5-bis(3,3-diethoxyprop-1-ynyl)naphthalene (PubChem CID 169050148) has the molecular formula C32H44O4 and a molecular weight of 492.70 g/mol. Its IUPAC name is 2,6-ditert-butyl-1,5-bis(3,3-diethoxyprop-1-ynyl)naphthalene.
| Compound Name | 2,6-ditert-butyl-1,5-bis(3,3-diethoxyprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 169050148 |
| Molecular Formula | C32H44O4 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 2,6-ditert-butyl-1,5-bis(3,3-diethoxyprop-1-ynyl)naphthalene |
| SMILES | CCOC(C#Cc1c(C(C)(C)C)ccc2c(C#CC(OCC)OCC)c(C(C)(C)C)ccc12)OCC |
| InChI | InChI=1S/C32H44O4/c1-11-33-29(34-12-2)21-17-25-23-15-20-28(32(8,9)10)26(18-22-30(35-13-3)36-14-4)24(23)16-19-27(25)31(5,6)7/h15-16,19-20,29-30H,11-14H2,1-10H3 |
| InChIKey | PMBSJVILFKBXOK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|