About 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole
2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole (PubChem CID 169050387) has the molecular formula C26H30N2
and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole.
Molecular Properties
| Compound Name | 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole |
| PubChem CID | 169050387 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole |
| SMILES | CC(C)(C)c1ccc2c(-c3ccc[nH]3)c(C(C)(C)C)ccc2c1-c1ccc[nH]1 |
| InChI | InChI=1S/C26H30N2/c1-25(2,3)19-13-11-18-17(23(19)21-9-7-15-27-21)12-14-20(26(4,5)6)24(18)22-10-8-16-28-22/h7-16,27-28H,1-6H3 |
| InChIKey | SBDLDMGKKXFRDX-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole?
The IUPAC name of 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole (CID 169050387) is 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole.
What is the SMILES notation for 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole?
The canonical SMILES for 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole is CC(C)(C)c1ccc2c(-c3ccc[nH]3)c(C(C)(C)C)ccc2c1-c1ccc[nH]1.
What is the InChIKey of 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole?
The InChIKey is SBDLDMGKKXFRDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2/c1-25(2,3)19-13-11-18-17(23(19)21-9-7-15-27-21)12-14-20(26(4,5)6)24(18)22-10-8-16-28-22/h7-16,27-28H,1-6H3.
What are the key properties of 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole?
2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole has a molecular weight of 370.54 g/mol, XLogP of 7.43, 2 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-ditert-butyl-5-(1H-pyrrol-2-yl)naphthalen-1-yl]-1H-pyrrole is sourced from PubChem (CID 169050387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).