About 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan
2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan (PubChem CID 169050457) has the molecular formula C26H28O2
and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan.
Molecular Properties
| Compound Name | 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan |
| PubChem CID | 169050457 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)c(-c3ccco3)cc2cc1-c1ccco1 |
| InChI | InChI=1S/C26H28O2/c1-25(2,3)21-15-18-16-22(26(4,5)6)20(24-10-8-12-28-24)14-17(18)13-19(21)23-9-7-11-27-23/h7-16H,1-6H3 |
| InChIKey | NVYJQWZGIQUABQ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan?
The IUPAC name of 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan (CID 169050457) is 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan.
What is the SMILES notation for 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan?
The canonical SMILES for 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan is CC(C)(C)c1cc2cc(C(C)(C)C)c(-c3ccco3)cc2cc1-c1ccco1.
What is the InChIKey of 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan?
The InChIKey is NVYJQWZGIQUABQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28O2/c1-25(2,3)21-15-18-16-22(26(4,5)6)20(24-10-8-12-28-24)14-17(18)13-19(21)23-9-7-11-27-23/h7-16H,1-6H3.
What are the key properties of 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan?
2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan has a molecular weight of 372.51 g/mol, XLogP of 7.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,6-ditert-butyl-7-(furan-2-yl)naphthalen-2-yl]furan is sourced from PubChem (CID 169050457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).