About 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide
2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide (PubChem CID 169052003) has the molecular formula C12H22N2O4S
and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide.
Molecular Properties
| Compound Name | 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide |
| PubChem CID | 169052003 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide |
| SMILES | C[N+](C)([O-])CCOc1cscc1OCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C12H22N2O4S/c1-13(2,15)5-7-17-11-9-19-10-12(11)18-8-6-14(3,4)16/h9-10H,5-8H2,1-4H3 |
| InChIKey | GAIPZOLJBMVDDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide?
The IUPAC name of 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide (CID 169052003) is 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide.
What is the SMILES notation for 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide?
The canonical SMILES for 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide is C[N+](C)([O-])CCOc1cscc1OCC[N+](C)(C)[O-].
What is the InChIKey of 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide?
The InChIKey is GAIPZOLJBMVDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c1-13(2,15)5-7-17-11-9-19-10-12(11)18-8-6-14(3,4)16/h9-10H,5-8H2,1-4H3.
What are the key properties of 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide?
2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide has a molecular weight of 290.38 g/mol, XLogP of 1.65, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[dimethyl(oxido)azaniumyl]ethoxy]thiophen-3-yl]oxy-N,N-dimethylethanamine oxide is sourced from PubChem (CID 169052003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).