C17H21ClFN5 — CID 169052114
5-(2-chloropyrimidin-4-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline (PubChem CID 169052114) has the molecular formula C17H21ClFN5 and a molecular weight of 349.84 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline.
| Compound Name | 5-(2-chloropyrimidin-4-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 169052114 |
| Molecular Formula | C17H21ClFN5 |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]aniline |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3ccnc(Cl)n3)cc2N)C[C@H](C)N1C |
| InChI | InChI=1S/C17H21ClFN5/c1-10-8-24(9-11(2)23(10)3)16-7-13(19)12(6-14(16)20)15-4-5-21-17(18)22-15/h4-7,10-11H,8-9,20H2,1-3H3/t10-,11+ |
| InChIKey | FXNOEYDRIJSPAS-PHIMTYICSA-N |
| XLogP | 3.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|