About lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide
lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide (PubChem CID 169053976) has the molecular formula C10H10F2LiO5S-
and a molecular weight of 287.19 g/mol. Its IUPAC name is lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide.
Molecular Properties
| Compound Name | lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide |
| PubChem CID | 169053976 |
| Molecular Formula | C10H10F2LiO5S- |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide |
| SMILES | O=[C-]c1ccc(S(=O)(=O)CC2CC(F)(F)C2)o1.[Li+].[OH-] |
| InChI | InChI=1S/C10H9F2O4S.Li.H2O/c11-10(12)3-7(4-10)6-17(14,15)9-2-1-8(5-13)16-9;;/h1-2,7H,3-4,6H2;;1H2/q-1;+1;/p-1 |
| InChIKey | WOAWGNCTACVFEV-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide?
The IUPAC name of lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide (CID 169053976) is lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide.
What is the SMILES notation for lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide?
The canonical SMILES for lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide is O=[C-]c1ccc(S(=O)(=O)CC2CC(F)(F)C2)o1.[Li+].[OH-].
What is the InChIKey of lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide?
The InChIKey is WOAWGNCTACVFEV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9F2O4S.Li.H2O/c11-10(12)3-7(4-10)6-17(14,15)9-2-1-8(5-13)16-9;;/h1-2,7H,3-4,6H2;;1H2/q-1;+1;/p-1.
What are the key properties of lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide?
lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide has a molecular weight of 287.19 g/mol, XLogP of -1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;[5-[(3,3-difluorocyclobutyl)methylsulfonyl]furan-2-yl]methanone;hydroxide is sourced from PubChem (CID 169053976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).