C24H20ClF2N8O5P — CID 169058563
[4-[2-[(3S,8aR)-7-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-3-yl]-1H-imidazol-5-yl]-3-fluoro-2-pyridinyl]methyl dihydrogen phosphate (PubChem CID 169058563) has the molecular formula C24H20ClF2N8O5P and a molecular weight of 604.90 g/mol. Its IUPAC name is [4-[2-[(3S,8aR)-7-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-3-yl]-1H-imidazol-5-yl]-3-fluoro-2-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [4-[2-[(3S,8aR)-7-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-3-yl]-1H-imidazol-5-yl]-3-fluoro-2-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 169058563 |
| Molecular Formula | C24H20ClF2N8O5P |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | [4-[2-[(3S,8aR)-7-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-3-yl]-1H-imidazol-5-yl]-3-fluoro-2-pyridinyl]methyl dihydrogen phosphate |
| SMILES | O=C1C=C(c2c(-n3cnnn3)ccc(Cl)c2F)C[C@H]2CC[C@@H](c3ncc(-c4ccnc(COP(=O)(O)O)c4F)[nH]3)N12 |
| InChI | InChI=1S/C24H20ClF2N8O5P/c25-15-2-4-18(34-11-30-32-33-34)21(23(15)27)12-7-13-1-3-19(35(13)20(36)8-12)24-29-9-16(31-24)14-5-6-28-17(22(14)26)10-40-41(37,38)39/h2,4-6,8-9,11,13,19H,1,3,7,10H2,(H,29,31)(H2,37,38,39)/t13-,19+/m1/s1 |
| InChIKey | ZVQVAMLHDBSHQK-YJYMSZOUSA-N |
| XLogP | 3.51 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|