C21H18ClN3O2 — CID 169058729
8-chloro-N-methyl-N-[(1R)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]indolizine-2-carboxamide (PubChem CID 169058729) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 8-chloro-N-methyl-N-[(1R)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]indolizine-2-carboxamide.
| Compound Name | 8-chloro-N-methyl-N-[(1R)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 169058729 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 8-chloro-N-methyl-N-[(1R)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]indolizine-2-carboxamide |
| SMILES | C[C@H](c1c[nH]c(=O)c2ccccc12)N(C)C(=O)c1cc2c(Cl)cccn2c1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-13(17-11-23-20(26)16-7-4-3-6-15(16)17)24(2)21(27)14-10-19-18(22)8-5-9-25(19)12-14/h3-13H,1-2H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | UGXXRQBFZMCPFS-CYBMUJFWSA-N |
| XLogP | 4.27 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |