C39H23N3OS — CID 169059388
2-(8-dibenzofuran-3-yldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 169059388) has the molecular formula C39H23N3OS and a molecular weight of 581.70 g/mol. Its IUPAC name is 2-(8-dibenzofuran-3-yldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(8-dibenzofuran-3-yldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 169059388 |
| Molecular Formula | C39H23N3OS |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 2-(8-dibenzofuran-3-yldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4sc5ccc(-c6ccc7c(c6)oc6ccccc67)cc5c34)n2)cc1 |
| InChI | InChI=1S/C39H23N3OS/c1-3-10-24(11-4-1)37-40-38(25-12-5-2-6-13-25)42-39(41-37)30-15-9-17-35-36(30)31-22-26(19-21-34(31)44-35)27-18-20-29-28-14-7-8-16-32(28)43-33(29)23-27/h1-23H |
| InChIKey | GCUUSCSEWOAXNM-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |