C41H80O6 — CID 169059593
nonyl 8-[4,4-dimethyl-2-(8-nonoxy-8-oxooctoxy)pentoxy]octanoate (PubChem CID 169059593) has the molecular formula C41H80O6 and a molecular weight of 669.09 g/mol. Its IUPAC name is nonyl 8-[4,4-dimethyl-2-(8-nonoxy-8-oxooctoxy)pentoxy]octanoate.
| Compound Name | nonyl 8-[4,4-dimethyl-2-(8-nonoxy-8-oxooctoxy)pentoxy]octanoate |
|---|---|
| PubChem CID | 169059593 |
| Molecular Formula | C41H80O6 |
| Molecular Weight | 669.09 g/mol |
| Exact Mass | 668.60 |
| IUPAC Name | nonyl 8-[4,4-dimethyl-2-(8-nonoxy-8-oxooctoxy)pentoxy]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCOCC(CC(C)(C)C)OCCCCCCCC(=O)OCCCCCCCCC |
| InChI | InChI=1S/C41H80O6/c1-6-8-10-12-14-21-28-34-46-39(42)30-24-18-16-20-26-32-44-37-38(36-41(3,4)5)45-33-27-23-17-19-25-31-40(43)47-35-29-22-15-13-11-9-7-2/h38H,6-37H2,1-5H3 |
| InChIKey | GUUYZIFWRPQFJS-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.09 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|