About 3-diazenyl-1H-indol-2-ol
3-diazenyl-1H-indol-2-ol (PubChem CID 16906) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-diazenyl-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-diazenyl-1H-indol-2-ol |
| PubChem CID | 16906 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-diazenyl-1H-indol-2-ol |
| SMILES | [H]/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C8H7N3O/c9-11-7-5-3-1-2-4-6(5)10-8(7)12/h1-4,9-10,12H/b11-9+ |
| InChIKey | KWSQYVPIKHBAQV-PKNBQFBNSA-N |
| XLogP | 2.54 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-diazenyl-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazenyl-1H-indol-2-ol?
The IUPAC name of 3-diazenyl-1H-indol-2-ol (CID 16906) is 3-diazenyl-1H-indol-2-ol.
What is the SMILES notation for 3-diazenyl-1H-indol-2-ol?
The canonical SMILES for 3-diazenyl-1H-indol-2-ol is [H]/N=N/c1c(O)[nH]c2ccccc12.
What is the InChIKey of 3-diazenyl-1H-indol-2-ol?
The InChIKey is KWSQYVPIKHBAQV-PKNBQFBNSA-N. The full InChI is InChI=1S/C8H7N3O/c9-11-7-5-3-1-2-4-6(5)10-8(7)12/h1-4,9-10,12H/b11-9+.
What are the key properties of 3-diazenyl-1H-indol-2-ol?
3-diazenyl-1H-indol-2-ol has a molecular weight of 161.16 g/mol, XLogP of 2.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazenyl-1H-indol-2-ol is sourced from PubChem (CID 16906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).