C26H30N4O4 — CID 169060363
11-benzyl-7-[(3,4,5-trimethoxyphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060363) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 11-benzyl-7-[(3,4,5-trimethoxyphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 11-benzyl-7-[(3,4,5-trimethoxyphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060363 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 11-benzyl-7-[(3,4,5-trimethoxyphenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | COc1cc(CN2C(=O)C3=C(CCN(Cc4ccccc4)C3)N3CCN=C23)cc(OC)c1OC |
| InChI | InChI=1S/C26H30N4O4/c1-32-22-13-19(14-23(33-2)24(22)34-3)16-30-25(31)20-17-28(15-18-7-5-4-6-8-18)11-9-21(20)29-12-10-27-26(29)30/h4-8,13-14H,9-12,15-17H2,1-3H3 |
| InChIKey | JBEZFLUDVLJUNV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |