C31H37F3N2O3 — CID 169061039
ethyl 1-[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate (PubChem CID 169061039) has the molecular formula C31H37F3N2O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is ethyl 1-[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate.
| Compound Name | ethyl 1-[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 169061039 |
| Molecular Formula | C31H37F3N2O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | ethyl 1-[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(C2CCc3cc(/C(C)=N/OCc4ccc(C5CCCCC5)c(C(F)(F)F)c4)ccc32)C1 |
| InChI | InChI=1S/C31H37F3N2O3/c1-3-38-30(37)25-17-36(18-25)29-14-11-24-16-23(10-13-27(24)29)20(2)35-39-19-21-9-12-26(22-7-5-4-6-8-22)28(15-21)31(32,33)34/h9-10,12-13,15-16,22,25,29H,3-8,11,14,17-19H2,1-2H3/b35-20+ |
| InChIKey | FZMYQHWKQBAQKX-JEPNHJGPSA-N |
| XLogP | 7.18 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|