C34H23N3S — CID 169061390
N,N-bis(4-pyridin-4-ylphenyl)dibenzothiophen-2-amine (PubChem CID 169061390) has the molecular formula C34H23N3S and a molecular weight of 505.65 g/mol. Its IUPAC name is N,N-bis(4-pyridin-4-ylphenyl)dibenzothiophen-2-amine.
| Compound Name | N,N-bis(4-pyridin-4-ylphenyl)dibenzothiophen-2-amine |
|---|---|
| PubChem CID | 169061390 |
| Molecular Formula | C34H23N3S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | N,N-bis(4-pyridin-4-ylphenyl)dibenzothiophen-2-amine |
| SMILES | c1ccc2c(c1)sc1ccc(N(c3ccc(-c4ccncc4)cc3)c3ccc(-c4ccncc4)cc3)cc12 |
| InChI | InChI=1S/C34H23N3S/c1-2-4-33-31(3-1)32-23-30(13-14-34(32)38-33)37(28-9-5-24(6-10-28)26-15-19-35-20-16-26)29-11-7-25(8-12-29)27-17-21-36-22-18-27/h1-23H |
| InChIKey | QKDGCNLKYCXVHW-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |