About (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine
(5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine (PubChem CID 169061691) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine.
Molecular Properties
| Compound Name | (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine |
| PubChem CID | 169061691 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine |
| SMILES | CC(C)/C1=C/c2ccccc2/N=C\CC1 |
| InChI | InChI=1S/C14H17N/c1-11(2)12-7-5-9-15-14-8-4-3-6-13(14)10-12/h3-4,6,8-11H,5,7H2,1-2H3/b12-10+,15-9- |
| InChIKey | RQCQHZFANIEQLC-YETLEGOWSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine?
The IUPAC name of (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine (CID 169061691) is (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine.
What is the SMILES notation for (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine?
The canonical SMILES for (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine is CC(C)/C1=C/c2ccccc2/N=C\CC1.
What is the InChIKey of (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine?
The InChIKey is RQCQHZFANIEQLC-YETLEGOWSA-N. The full InChI is InChI=1S/C14H17N/c1-11(2)12-7-5-9-15-14-8-4-3-6-13(14)10-12/h3-4,6,8-11H,5,7H2,1-2H3/b12-10+,15-9-.
What are the key properties of (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine?
(5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine has a molecular weight of 199.30 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-propan-2-yl-3,4-dihydro-1-benzazocine is sourced from PubChem (CID 169061691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).