About 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol
2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 169065731) has the molecular formula C8H19NO6
and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| PubChem CID | 169065731 |
| Molecular Formula | C8H19NO6 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(O)(O)N(CO)C(CO)(CO)CO |
| InChI | InChI=1S/C8H19NO6/c1-2-8(14,15)9(6-13)7(3-10,4-11)5-12/h10-15H,2-6H2,1H3 |
| InChIKey | RYRYPTSGXUXCCQ-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The IUPAC name of 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol (CID 169065731) is 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol.
What is the SMILES notation for 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The canonical SMILES for 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol is CCC(O)(O)N(CO)C(CO)(CO)CO.
What is the InChIKey of 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The InChIKey is RYRYPTSGXUXCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO6/c1-2-8(14,15)9(6-13)7(3-10,4-11)5-12/h10-15H,2-6H2,1H3.
What are the key properties of 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol has a molecular weight of 225.24 g/mol, XLogP of -3.00, 7 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1-dihydroxypropyl(hydroxymethyl)amino]-2-(hydroxymethyl)propane-1,3-diol is sourced from PubChem (CID 169065731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).