C33H38F2N3O7PS — CID 169067280
[[2-[[(1S)-1-cyclohexyl-2-oxo-2-[(2S)-2-[(2R)-2-phenylmorpholine-4-carbonyl]pyrrolidin-1-yl]ethyl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid (PubChem CID 169067280) has the molecular formula C33H38F2N3O7PS and a molecular weight of 689.72 g/mol. Its IUPAC name is [[2-[[(1S)-1-cyclohexyl-2-oxo-2-[(2S)-2-[(2R)-2-phenylmorpholine-4-carbonyl]pyrrolidin-1-yl]ethyl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-[[(1S)-1-cyclohexyl-2-oxo-2-[(2S)-2-[(2R)-2-phenylmorpholine-4-carbonyl]pyrrolidin-1-yl]ethyl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 169067280 |
| Molecular Formula | C33H38F2N3O7PS |
| Molecular Weight | 689.72 g/mol |
| Exact Mass | 689.21 |
| IUPAC Name | [[2-[[(1S)-1-cyclohexyl-2-oxo-2-[(2S)-2-[(2R)-2-phenylmorpholine-4-carbonyl]pyrrolidin-1-yl]ethyl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(N[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCO[C@H](c2ccccc2)C1)C1CCCCC1)c1cc2cc(C(F)(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C33H38F2N3O7PS/c34-33(35,46(42,43)44)24-13-14-27-23(18-24)19-28(47-27)30(39)36-29(22-10-5-2-6-11-22)32(41)38-15-7-12-25(38)31(40)37-16-17-45-26(20-37)21-8-3-1-4-9-21/h1,3-4,8-9,13-14,18-19,22,25-26,29H,2,5-7,10-12,15-17,20H2,(H,36,39)(H2,42,43,44)/t25-,26-,29-/m0/s1 |
| InChIKey | UGQJPJABSBAQPU-ZEZDXWPOSA-N |
| XLogP | 5.40 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|