C14H12N2O2S — CID 16906797
N-(2-thiophen-2-ylethyl)furo[3,2-b]pyridine-2-carboxamide (PubChem CID 16906797) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)furo[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-(2-thiophen-2-ylethyl)furo[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16906797 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)furo[3,2-b]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cc2ncccc2o1 |
| InChI | InChI=1S/C14H12N2O2S/c17-14(16-7-5-10-3-2-8-19-10)13-9-11-12(18-13)4-1-6-15-11/h1-4,6,8-9H,5,7H2,(H,16,17) |
| InChIKey | KHWHGECLGOFQBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |