C17H24ClN3O7 — CID 169068256
[(2R,3S,5R)-2-(chloromethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 169068256) has the molecular formula C17H24ClN3O7 and a molecular weight of 417.85 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(chloromethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,5R)-2-(chloromethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 169068256 |
| Molecular Formula | C17H24ClN3O7 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(2R,3S,5R)-2-(chloromethyl)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@@]1(CCl)O[C@@H](n2ncc(=O)[nH]c2=O)C[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C17H24ClN3O7/c1-9(2)14(23)26-8-17(7-18)11(27-15(24)10(3)4)5-13(28-17)21-16(25)20-12(22)6-19-21/h6,9-11,13H,5,7-8H2,1-4H3,(H,20,22,25)/t11-,13+,17+/m0/s1 |
| InChIKey | MANXZYGZPKQASM-XTQGRXLLSA-N |
| XLogP | 0.60 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|