C12H19F3O4 — CID 169068433
(2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-3,3,3-trifluoropropane-1,2-diol (PubChem CID 169068433) has the molecular formula C12H19F3O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 169068433 |
| Molecular Formula | C12H19F3O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-3,3,3-trifluoropropane-1,2-diol |
| SMILES | CC(C)=C[C@@H]1OC(C)(C)O[C@@H]1[C@](O)(CO)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O4/c1-7(2)5-8-9(19-10(3,4)18-8)11(17,6-16)12(13,14)15/h5,8-9,16-17H,6H2,1-4H3/t8-,9-,11+/m0/s1 |
| InChIKey | DAFISJXDXHLKPN-ATZCPNFKSA-N |
| XLogP | 1.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|