C19H31NO7S — CID 169069178
tert-butyl (3Z)-4-(methoxycarbonyloxymethylsulfanyl)-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate (PubChem CID 169069178) has the molecular formula C19H31NO7S and a molecular weight of 417.52 g/mol. Its IUPAC name is tert-butyl (3Z)-4-(methoxycarbonyloxymethylsulfanyl)-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3Z)-4-(methoxycarbonyloxymethylsulfanyl)-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169069178 |
| Molecular Formula | C19H31NO7S |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl (3Z)-4-(methoxycarbonyloxymethylsulfanyl)-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate |
| SMILES | COC(=O)OCSC1CCN(C(=O)OC(C)(C)C)C/C1=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31NO7S/c1-18(2,3)26-15(21)10-13-11-20(16(22)27-19(4,5)6)9-8-14(13)28-12-25-17(23)24-7/h10,14H,8-9,11-12H2,1-7H3/b13-10- |
| InChIKey | ZYQFPFXHOBWVOQ-RAXLEYEMSA-N |
| XLogP | 3.74 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|