About methyl 2-sulfanylacetate
methyl 2-sulfanylacetate (PubChem CID 16907) has the molecular formula C3H6O2S
and a molecular weight of 106.15 g/mol. Its IUPAC name is methyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-sulfanylacetate |
| PubChem CID | 16907 |
| Molecular Formula | C3H6O2S |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | methyl 2-sulfanylacetate |
| SMILES | COC(=O)CS |
| InChI | InChI=1S/C3H6O2S/c1-5-3(4)2-6/h6H,2H2,1H3 |
| InChIKey | MKIJJIMOAABWGF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-sulfanylacetate?
The IUPAC name of methyl 2-sulfanylacetate (CID 16907) is methyl 2-sulfanylacetate.
What is the SMILES notation for methyl 2-sulfanylacetate?
The canonical SMILES for methyl 2-sulfanylacetate is COC(=O)CS.
What is the InChIKey of methyl 2-sulfanylacetate?
The InChIKey is MKIJJIMOAABWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S/c1-5-3(4)2-6/h6H,2H2,1H3.
What are the key properties of methyl 2-sulfanylacetate?
methyl 2-sulfanylacetate has a molecular weight of 106.15 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-sulfanylacetate is sourced from PubChem (CID 16907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).