C58H59BN4 — CID 169072522
12,18-bis(3,5-ditert-butylphenyl)-15-pyrimidin-2-yl-12,18-diaza-1-boraheptacyclo[15.11.1.02,11.04,9.013,29.019,28.021,26]nonacosa-2,4,6,8,10,13,15,17(29),19,21,23,25,27-tridecaene (PubChem CID 169072522) has the molecular formula C58H59BN4 and a molecular weight of 822.95 g/mol. Its IUPAC name is 12,18-bis(3,5-ditert-butylphenyl)-15-pyrimidin-2-yl-12,18-diaza-1-boraheptacyclo[15.11.1.02,11.04,9.013,29.019,28.021,26]nonacosa-2,4,6,8,10,13,15,17(29),19,21,23,25,27-tridecaene.
| Compound Name | 12,18-bis(3,5-ditert-butylphenyl)-15-pyrimidin-2-yl-12,18-diaza-1-boraheptacyclo[15.11.1.02,11.04,9.013,29.019,28.021,26]nonacosa-2,4,6,8,10,13,15,17(29),19,21,23,25,27-tridecaene |
|---|---|
| PubChem CID | 169072522 |
| Molecular Formula | C58H59BN4 |
| Molecular Weight | 822.95 g/mol |
| Exact Mass | 822.48 |
| IUPAC Name | 12,18-bis(3,5-ditert-butylphenyl)-15-pyrimidin-2-yl-12,18-diaza-1-boraheptacyclo[15.11.1.02,11.04,9.013,29.019,28.021,26]nonacosa-2,4,6,8,10,13,15,17(29),19,21,23,25,27-tridecaene |
| SMILES | CC(C)(C)c1cc(N2c3cc4ccccc4cc3B3c4cc5ccccc5cc4N(c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4cc(-c5ncccn5)cc2c43)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C58H59BN4/c1-55(2,3)41-30-42(56(4,5)6)33-45(32-41)62-49-26-38-20-15-13-18-36(38)24-47(49)59-48-25-37-19-14-16-21-39(37)27-50(48)63(46-34-43(57(7,8)9)31-44(35-46)58(10,11)12)52-29-40(28-51(62)53(52)59)54-60-22-17-23-61-54/h13-35H,1-12H3 |
| InChIKey | RYKNIPRQNGLQOT-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.95 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|