C19H19FN4O3 — CID 169073301
5-(2-cyclopropyloxy-5-isocyanophenyl)-N-[(3R,5S)-5-(fluoromethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide (PubChem CID 169073301) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 5-(2-cyclopropyloxy-5-isocyanophenyl)-N-[(3R,5S)-5-(fluoromethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(2-cyclopropyloxy-5-isocyanophenyl)-N-[(3R,5S)-5-(fluoromethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 169073301 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-(2-cyclopropyloxy-5-isocyanophenyl)-N-[(3R,5S)-5-(fluoromethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(OC2CC2)c(-c2cnc(C(=O)N[C@H]3CN[C@H](CF)C3)o2)c1 |
| InChI | InChI=1S/C19H19FN4O3/c1-21-11-2-5-16(26-14-3-4-14)15(7-11)17-10-23-19(27-17)18(25)24-13-6-12(8-20)22-9-13/h2,5,7,10,12-14,22H,3-4,6,8-9H2,(H,24,25)/t12-,13+/m0/s1 |
| InChIKey | UFNLQUPPDVTRJB-QWHCGFSZSA-N |
| XLogP | 2.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|