C47H46F2N14OS2 — CID 169073882
bis[2-(4-ethylpiperazin-1-yl)-6-[[5-fluoro-4-(2-methyl-1,3-benzothiazol-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methanone (PubChem CID 169073882) has the molecular formula C47H46F2N14OS2 and a molecular weight of 925.11 g/mol. Its IUPAC name is bis[2-(4-ethylpiperazin-1-yl)-6-[[5-fluoro-4-(2-methyl-1,3-benzothiazol-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methanone.
| Compound Name | bis[2-(4-ethylpiperazin-1-yl)-6-[[5-fluoro-4-(2-methyl-1,3-benzothiazol-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 169073882 |
| Molecular Formula | C47H46F2N14OS2 |
| Molecular Weight | 925.11 g/mol |
| Exact Mass | 924.34 |
| IUPAC Name | bis[2-(4-ethylpiperazin-1-yl)-6-[[5-fluoro-4-(2-methyl-1,3-benzothiazol-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]methanone |
| SMILES | CCN1CCN(c2nc(Nc3ncc(F)c(-c4ccc5nc(C)sc5c4)n3)ccc2C(=O)c2ccc(Nc3ncc(F)c(-c4ccc5nc(C)sc5c4)n3)nc2N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C47H46F2N14OS2/c1-5-60-15-19-62(20-16-60)44-31(9-13-39(54-44)56-46-50-25-33(48)41(58-46)29-7-11-35-37(23-29)65-27(3)52-35)43(64)32-10-14-40(55-45(32)63-21-17-61(6-2)18-22-63)57-47-51-26-34(49)42(59-47)30-8-12-36-38(24-30)66-28(4)53-36/h7-14,23-26H,5-6,15-22H2,1-4H3,(H,50,54,56,58)(H,51,55,57,59) |
| InChIKey | MWNKGJHBMPOWIZ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.11 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |