C24H27FN8O2S2 — CID 169073884
6-[5-fluoro-2-[[5-[(4-methylperoxysulfanylpiperazin-1-yl)methyl]-2-pyridinyl]amino]pyrimidin-4-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 169073884) has the molecular formula C24H27FN8O2S2 and a molecular weight of 542.67 g/mol. Its IUPAC name is 6-[5-fluoro-2-[[5-[(4-methylperoxysulfanylpiperazin-1-yl)methyl]-2-pyridinyl]amino]pyrimidin-4-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-[5-fluoro-2-[[5-[(4-methylperoxysulfanylpiperazin-1-yl)methyl]-2-pyridinyl]amino]pyrimidin-4-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 169073884 |
| Molecular Formula | C24H27FN8O2S2 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 6-[5-fluoro-2-[[5-[(4-methylperoxysulfanylpiperazin-1-yl)methyl]-2-pyridinyl]amino]pyrimidin-4-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | COOSN1CCN(Cc2ccc(Nc3ncc(F)c(-c4ccc5nc(N(C)C)sc5c4)n3)nc2)CC1 |
| InChI | InChI=1S/C24H27FN8O2S2/c1-31(2)24-28-19-6-5-17(12-20(19)36-24)22-18(25)14-27-23(30-22)29-21-7-4-16(13-26-21)15-32-8-10-33(11-9-32)37-35-34-3/h4-7,12-14H,8-11,15H2,1-3H3,(H,26,27,29,30) |
| InChIKey | CWJYPTXNZHHIRN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|