About 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol
1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol (PubChem CID 169073967) has the molecular formula C9H18F3NO
and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol |
| PubChem CID | 169073967 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol |
| SMILES | CCN(CC)CC(C)(O)CC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO/c1-4-13(5-2)7-8(3,14)6-9(10,11)12/h14H,4-7H2,1-3H3 |
| InChIKey | GKPGHVRTJZQRPJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol?
The IUPAC name of 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol (CID 169073967) is 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol.
What is the SMILES notation for 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol?
The canonical SMILES for 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol is CCN(CC)CC(C)(O)CC(F)(F)F.
What is the InChIKey of 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol?
The InChIKey is GKPGHVRTJZQRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO/c1-4-13(5-2)7-8(3,14)6-9(10,11)12/h14H,4-7H2,1-3H3.
What are the key properties of 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol?
1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol has a molecular weight of 213.24 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)-4,4,4-trifluoro-2-methylbutan-2-ol is sourced from PubChem (CID 169073967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).