About 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione
1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione (PubChem CID 169074226) has the molecular formula C19H16N2S3
and a molecular weight of 368.55 g/mol. Its IUPAC name is 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione.
Molecular Properties
| Compound Name | 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione |
| PubChem CID | 169074226 |
| Molecular Formula | C19H16N2S3 |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione |
| SMILES | C=Cc1ccc(-n2c(S)c(S)n(-c3ccc(C=C)cc3)c2=S)cc1 |
| InChI | InChI=1S/C19H16N2S3/c1-3-13-5-9-15(10-6-13)20-17(22)18(23)21(19(20)24)16-11-7-14(4-2)8-12-16/h3-12,22-23H,1-2H2 |
| InChIKey | SGRDCWWXSNQFMA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione?
The IUPAC name of 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione (CID 169074226) is 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione.
What is the SMILES notation for 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione?
The canonical SMILES for 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione is C=Cc1ccc(-n2c(S)c(S)n(-c3ccc(C=C)cc3)c2=S)cc1.
What is the InChIKey of 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione?
The InChIKey is SGRDCWWXSNQFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2S3/c1-3-13-5-9-15(10-6-13)20-17(22)18(23)21(19(20)24)16-11-7-14(4-2)8-12-16/h3-12,22-23H,1-2H2.
What are the key properties of 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione?
1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione has a molecular weight of 368.55 g/mol, XLogP of 5.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-ethenylphenyl)-4,5-bis(sulfanyl)imidazole-2-thione is sourced from PubChem (CID 169074226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).