C11H11FN5O3Y- — CID 169074267
(3-fluorocyclopentyl) 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate;yttrium (PubChem CID 169074267) has the molecular formula C11H11FN5O3Y- and a molecular weight of 369.15 g/mol. Its IUPAC name is (3-fluorocyclopentyl) 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate;yttrium.
| Compound Name | (3-fluorocyclopentyl) 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate;yttrium |
|---|---|
| PubChem CID | 169074267 |
| Molecular Formula | C11H11FN5O3Y- |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | (3-fluorocyclopentyl) 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate;yttrium |
| SMILES | Cn1nnc2c(C(=O)OC3C[CH-]C(F)C3)ncn2c1=O.[Y] |
| InChI | InChI=1S/C11H11FN5O3.Y/c1-16-11(19)17-5-13-8(9(17)14-15-16)10(18)20-7-3-2-6(12)4-7;/h2,5-7H,3-4H2,1H3;/q-1; |
| InChIKey | YTYWUEYSZZNHOS-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|