C34H62O2Si2 — CID 169074605
tert-butyl-[(3Z,6S,7E,9E,11E,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxydocosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane (PubChem CID 169074605) has the molecular formula C34H62O2Si2 and a molecular weight of 559.04 g/mol. Its IUPAC name is tert-butyl-[(3Z,6S,7E,9E,11E,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxydocosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3Z,6S,7E,9E,11E,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxydocosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 169074605 |
| Molecular Formula | C34H62O2Si2 |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | tert-butyl-[(3Z,6S,7E,9E,11E,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxydocosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C/C=C/[C@H](C/C=C\C/C=C\CCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H62O2Si2/c1-13-15-17-18-19-20-24-28-32(36-38(11,12)34(6,7)8)30-26-22-21-25-29-31(27-23-16-14-2)35-37(9,10)33(3,4)5/h16-18,20-26,29-32H,13-15,19,27-28H2,1-12H3/b18-17-,22-21+,23-16-,24-20-,29-25+,30-26+/t31-,32-/m0/s1 |
| InChIKey | ROOJBQYTGGVNGY-VCPAZXITSA-N |
| XLogP | 11.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|