C18H19FN6 — CID 169074701
5-(12-ethylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)-2-fluoro-4-methylaniline (PubChem CID 169074701) has the molecular formula C18H19FN6 and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-(12-ethylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)-2-fluoro-4-methylaniline.
| Compound Name | 5-(12-ethylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)-2-fluoro-4-methylaniline |
|---|---|
| PubChem CID | 169074701 |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 5-(12-ethylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)-2-fluoro-4-methylaniline |
| SMILES | CC/N=c1\ncc2cc(-c3cc(N)c(F)cc3C)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C18H19FN6/c1-3-21-18-23-9-11-7-13(12-8-15(20)14(19)6-10(12)2)17-22-4-5-25(17)16(11)24-18/h6-9,22H,3-5,20H2,1-2H3/b21-18+ |
| InChIKey | XFLUHZSYMGNGNT-DYTRJAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|