C30H26N8S — CID 169075045
7-(4-amino-2-methylphenyl)-N-methyl-N-[4-(4-methylthiophen-2-yl)phthalazin-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-12-amine (PubChem CID 169075045) has the molecular formula C30H26N8S and a molecular weight of 530.66 g/mol. Its IUPAC name is 7-(4-amino-2-methylphenyl)-N-methyl-N-[4-(4-methylthiophen-2-yl)phthalazin-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-12-amine.
| Compound Name | 7-(4-amino-2-methylphenyl)-N-methyl-N-[4-(4-methylthiophen-2-yl)phthalazin-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-12-amine |
|---|---|
| PubChem CID | 169075045 |
| Molecular Formula | C30H26N8S |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 7-(4-amino-2-methylphenyl)-N-methyl-N-[4-(4-methylthiophen-2-yl)phthalazin-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-12-amine |
| SMILES | Cc1csc(-c2nnc(N(C)c3ncc4c(n3)N3CCN=C3C(c3ccc(N)cc3C)=C4)c3ccccc23)c1 |
| InChI | InChI=1S/C30H26N8S/c1-17-12-25(39-16-17)26-22-6-4-5-7-23(22)29(36-35-26)37(3)30-33-15-19-14-24(21-9-8-20(31)13-18(21)2)28-32-10-11-38(28)27(19)34-30/h4-9,12-16H,10-11,31H2,1-3H3 |
| InChIKey | SDPOEKYJFCVHPO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|