C28H24ClF5N4O3 — CID 169075842
1-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxo-1-[3-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea (PubChem CID 169075842) has the molecular formula C28H24ClF5N4O3 and a molecular weight of 594.97 g/mol. Its IUPAC name is 1-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxo-1-[3-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxo-1-[3-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 169075842 |
| Molecular Formula | C28H24ClF5N4O3 |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 1-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxo-1-[3-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea |
| SMILES | COc1cc(F)c([C@@H]2CN(c3ncccc3C(F)(F)F)C(=O)[C@H]2NC(=O)NC2CCc3cc(Cl)ccc3C2)c(F)c1 |
| InChI | InChI=1S/C28H24ClF5N4O3/c1-41-18-11-21(30)23(22(31)12-18)19-13-38(25-20(28(32,33)34)3-2-8-35-25)26(39)24(19)37-27(40)36-17-7-5-14-9-16(29)6-4-15(14)10-17/h2-4,6,8-9,11-12,17,19,24H,5,7,10,13H2,1H3,(H2,36,37,40)/t17?,19-,24-/m0/s1 |
| InChIKey | GQFADUNUDDGILT-IDCKRSQJSA-N |
| XLogP | 5.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |