About tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate
tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate (PubChem CID 169076035) has the molecular formula C29H42N2O4Si
and a molecular weight of 510.75 g/mol. Its IUPAC name is tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate |
| PubChem CID | 169076035 |
| Molecular Formula | C29H42N2O4Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H]2COC[C@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C29H42N2O4Si/c1-28(2,3)34-27(32)31-19-17-30(18-20-31)25-21-33-22-26(25)35-36(29(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,25-26H,17-22H2,1-6H3/t25-,26+/m0/s1 |
| InChIKey | QKHAXGOCKBNQFS-IZZNHLLZSA-N |
| XLogP | 3.88 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate (CID 169076035) is tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN([C@H]2COC[C@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate?
The InChIKey is QKHAXGOCKBNQFS-IZZNHLLZSA-N. The full InChI is InChI=1S/C29H42N2O4Si/c1-28(2,3)34-27(32)31-19-17-30(18-20-31)25-21-33-22-26(25)35-36(29(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,25-26H,17-22H2,1-6H3/t25-,26+/m0/s1.
What are the key properties of tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate?
tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate has a molecular weight of 510.75 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-3-yl]piperazine-1-carboxylate is sourced from PubChem (CID 169076035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).