C74H61ClIN3 — CID 169076568
5-chloro-1-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1-N,3-N-bis(2,6-diphenylphenyl)-3-N-(3-iodophenyl)benzene-1,3-diamine (PubChem CID 169076568) has the molecular formula C74H61ClIN3 and a molecular weight of 1154.68 g/mol. Its IUPAC name is 5-chloro-1-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1-N,3-N-bis(2,6-diphenylphenyl)-3-N-(3-iodophenyl)benzene-1,3-diamine.
| Compound Name | 5-chloro-1-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1-N,3-N-bis(2,6-diphenylphenyl)-3-N-(3-iodophenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 169076568 |
| Molecular Formula | C74H61ClIN3 |
| Molecular Weight | 1154.68 g/mol |
| Exact Mass | 1153.36 |
| IUPAC Name | 5-chloro-1-N-[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-1-N,3-N-bis(2,6-diphenylphenyl)-3-N-(3-iodophenyl)benzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc(N(c2cc(Cl)cc(N(c3cccc(I)c3)c3c(-c4ccccc4)cccc3-c3ccccc3)c2)c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C74H61ClIN3/c1-73(2,3)54-39-41-69-67(43-54)68-44-55(74(4,5)6)40-42-70(68)79(69)60-34-20-33-59(48-60)78(72-65(52-27-15-9-16-28-52)37-22-38-66(72)53-29-17-10-18-30-53)62-46-56(75)45-61(49-62)77(58-32-19-31-57(76)47-58)71-63(50-23-11-7-12-24-50)35-21-36-64(71)51-25-13-8-14-26-51/h7-49H,1-6H3 |
| InChIKey | JBXQEDDMLHYUMM-UHFFFAOYSA-N |
| XLogP | 22.24 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.68 |
| LogP ≤ 5 | 22.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|