C56H29B2N7O2Pt — CID 169077478
CID 169077478 (PubChem CID 169077478) has the molecular formula C56H29B2N7O2Pt and a molecular weight of 1048.60 g/mol.
| Compound Name | CID 169077478 |
|---|---|
| PubChem CID | 169077478 |
| Molecular Formula | C56H29B2N7O2Pt |
| Molecular Weight | 1048.60 g/mol |
| Exact Mass | 1048.22 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(-n2c3ccccc3n3c4ccccc4nc23)cc2c3c1N1c4[c-]c(-n5c6ccccc6n6c7ccccc7nc56)cc5c4B(c4ccccc4O5)c4cccc(c41)B3c1ccccc1O2 |
| InChI | InChI=1S/C56H29B2N7O2.Pt/c1-11-26-48-34(14-1)57-36-16-13-17-37-54(36)63(46-28-32(30-50(66-48)52(46)57)61-42-22-7-9-24-44(42)64-40-20-5-3-18-38(40)59-55(61)64)47-29-33(31-51-53(47)58(37)35-15-2-12-27-49(35)67-51)62-43-23-8-10-25-45(43)65-41-21-6-4-19-39(41)60-56(62)65;/h1-27,30-31H;/q-2;+2 |
| InChIKey | DKSBETPWTBMATJ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|