C22H27BN2O8S — CID 169078780
2,6-dimethoxy-N-[4-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]benzenesulfonamide (PubChem CID 169078780) has the molecular formula C22H27BN2O8S and a molecular weight of 490.34 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[4-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]benzenesulfonamide.
| Compound Name | 2,6-dimethoxy-N-[4-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 169078780 |
| Molecular Formula | C22H27BN2O8S |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2,6-dimethoxy-N-[4-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]benzenesulfonamide |
| SMILES | COc1cccc(OC)c1S(=O)(=O)Nc1noc2cc(B3OC(C)(C)C(C)(C)O3)cc(OC)c12 |
| InChI | InChI=1S/C22H27BN2O8S/c1-21(2)22(3,4)33-23(32-21)13-11-16(30-7)18-17(12-13)31-24-20(18)25-34(26,27)19-14(28-5)9-8-10-15(19)29-6/h8-12H,1-7H3,(H,24,25) |
| InChIKey | ADODWTFYLTWOSQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|