C23H19FN6O5S — CID 169078992
2-cyano-N-[[1-[[3-[(2-fluorophenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]pyrazol-4-yl]methyl]prop-2-enamide (PubChem CID 169078992) has the molecular formula C23H19FN6O5S and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-cyano-N-[[1-[[3-[(2-fluorophenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]pyrazol-4-yl]methyl]prop-2-enamide.
| Compound Name | 2-cyano-N-[[1-[[3-[(2-fluorophenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]pyrazol-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 169078992 |
| Molecular Formula | C23H19FN6O5S |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-cyano-N-[[1-[[3-[(2-fluorophenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]pyrazol-4-yl]methyl]prop-2-enamide |
| SMILES | C=C(C#N)C(=O)NCc1cnn(Cc2cc(OC)c3c(NS(=O)(=O)c4ccccc4F)noc3c2)c1 |
| InChI | InChI=1S/C23H19FN6O5S/c1-14(9-25)23(31)26-10-16-11-27-30(13-16)12-15-7-18(34-2)21-19(8-15)35-28-22(21)29-36(32,33)20-6-4-3-5-17(20)24/h3-8,11,13H,1,10,12H2,2H3,(H,26,31)(H,28,29) |
| InChIKey | SEHVFTILOUUHBK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|