C16H12F7N7OS — CID 169079320
(Z)-3-[3-[3-(difluoromethyl)-5-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-1-yl]-N-pyrazin-2-ylprop-2-enehydrazide (PubChem CID 169079320) has the molecular formula C16H12F7N7OS and a molecular weight of 483.37 g/mol. Its IUPAC name is (Z)-3-[3-[3-(difluoromethyl)-5-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-1-yl]-N-pyrazin-2-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-(difluoromethyl)-5-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-1-yl]-N-pyrazin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 169079320 |
| Molecular Formula | C16H12F7N7OS |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | (Z)-3-[3-[3-(difluoromethyl)-5-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-1-yl]-N-pyrazin-2-ylprop-2-enehydrazide |
| SMILES | NN(C(=O)/C=C\n1cnc(-c2cc(C(F)F)cc(S(F)(F)(F)(F)F)c2)n1)c1cnccn1 |
| InChI | InChI=1S/C16H12F7N7OS/c17-15(18)10-5-11(7-12(6-10)32(19,20,21,22)23)16-27-9-29(28-16)4-1-14(31)30(24)13-8-25-2-3-26-13/h1-9,15H,24H2/b4-1- |
| InChIKey | USYWVBYLUZSVSP-RJRFIUFISA-N |
| XLogP | 4.71 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|