C15H30O8 — CID 169079692
[3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl] hexanoate (PubChem CID 169079692) has the molecular formula C15H30O8 and a molecular weight of 338.40 g/mol. Its IUPAC name is [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl] hexanoate.
| Compound Name | [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl] hexanoate |
|---|---|
| PubChem CID | 169079692 |
| Molecular Formula | C15H30O8 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(O)COCC(O)COCC(O)CO |
| InChI | InChI=1S/C15H30O8/c1-2-3-4-5-15(20)23-11-14(19)10-22-9-13(18)8-21-7-12(17)6-16/h12-14,16-19H,2-11H2,1H3 |
| InChIKey | ZUTXLETYWICDLF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|