C20H18N4O2 — CID 169079774
N-[4-(4-methoxyanilino)-9H-pyrido[2,3-b]indol-7-yl]acetamide (PubChem CID 169079774) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[4-(4-methoxyanilino)-9H-pyrido[2,3-b]indol-7-yl]acetamide.
| Compound Name | N-[4-(4-methoxyanilino)-9H-pyrido[2,3-b]indol-7-yl]acetamide |
|---|---|
| PubChem CID | 169079774 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[4-(4-methoxyanilino)-9H-pyrido[2,3-b]indol-7-yl]acetamide |
| SMILES | COc1ccc(Nc2ccnc3[nH]c4cc(NC(C)=O)ccc4c23)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-12(25)22-14-5-8-16-18(11-14)24-20-19(16)17(9-10-21-20)23-13-3-6-15(26-2)7-4-13/h3-11H,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | FZLCYKDCZTUDKQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |