About 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one
5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one (PubChem CID 169079955) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one |
| PubChem CID | 169079955 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one |
| SMILES | CC1CC[C@H](Oc2ccc3c(c2)COC3=O)[C@@H]1N |
| InChI | InChI=1S/C14H17NO3/c1-8-2-5-12(13(8)15)18-10-3-4-11-9(6-10)7-17-14(11)16/h3-4,6,8,12-13H,2,5,7,15H2,1H3/t8?,12-,13+/m0/s1 |
| InChIKey | MPOAASVLKYQCBD-LFOGUXLASA-N |
| XLogP | 1.86 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one?
The IUPAC name of 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one (CID 169079955) is 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one.
What is the SMILES notation for 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one?
The canonical SMILES for 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one is CC1CC[C@H](Oc2ccc3c(c2)COC3=O)[C@@H]1N.
What is the InChIKey of 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one?
The InChIKey is MPOAASVLKYQCBD-LFOGUXLASA-N. The full InChI is InChI=1S/C14H17NO3/c1-8-2-5-12(13(8)15)18-10-3-4-11-9(6-10)7-17-14(11)16/h3-4,6,8,12-13H,2,5,7,15H2,1H3/t8?,12-,13+/m0/s1.
What are the key properties of 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one?
5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one has a molecular weight of 247.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2R)-2-amino-3-methylcyclopentyl]oxy-3H-2-benzofuran-1-one is sourced from PubChem (CID 169079955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).