About [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate
[(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate (PubChem CID 169079957) has the molecular formula C19H25NO5
and a molecular weight of 347.41 g/mol. Its IUPAC name is [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate |
| PubChem CID | 169079957 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate |
| SMILES | C[C@@H]1CCC(Oc2ccc3c(c2)COC3=O)[C@H]1OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H25NO5/c1-11-5-8-15(16(11)25-18(22)20-19(2,3)4)24-13-6-7-14-12(9-13)10-23-17(14)21/h6-7,9,11,15-16H,5,8,10H2,1-4H3,(H,20,22)/t11-,15?,16+/m1/s1 |
| InChIKey | PJRUJEPQICFSNM-KAVGXYGMSA-N |
| XLogP | 3.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate?
The IUPAC name of [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate (CID 169079957) is [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate.
What is the SMILES notation for [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate?
The canonical SMILES for [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate is C[C@@H]1CCC(Oc2ccc3c(c2)COC3=O)[C@H]1OC(=O)NC(C)(C)C.
What is the InChIKey of [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate?
The InChIKey is PJRUJEPQICFSNM-KAVGXYGMSA-N. The full InChI is InChI=1S/C19H25NO5/c1-11-5-8-15(16(11)25-18(22)20-19(2,3)4)24-13-6-7-14-12(9-13)10-23-17(14)21/h6-7,9,11,15-16H,5,8,10H2,1-4H3,(H,20,22)/t11-,15?,16+/m1/s1.
What are the key properties of [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate?
[(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate has a molecular weight of 347.41 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-methyl-5-[(1-oxo-3H-2-benzofuran-5-yl)oxy]cyclopentyl] N-tert-butylcarbamate is sourced from PubChem (CID 169079957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).