C15H12O9S2 — CID 169079970
2-hydroxy-5-[(E)-3-(4-hydroxy-3-sulfophenyl)-3-oxoprop-1-enyl]benzenesulfonic acid (PubChem CID 169079970) has the molecular formula C15H12O9S2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-hydroxy-5-[(E)-3-(4-hydroxy-3-sulfophenyl)-3-oxoprop-1-enyl]benzenesulfonic acid.
| Compound Name | 2-hydroxy-5-[(E)-3-(4-hydroxy-3-sulfophenyl)-3-oxoprop-1-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 169079970 |
| Molecular Formula | C15H12O9S2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 2-hydroxy-5-[(E)-3-(4-hydroxy-3-sulfophenyl)-3-oxoprop-1-enyl]benzenesulfonic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(S(=O)(=O)O)c1)c1ccc(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H12O9S2/c16-11(10-3-6-13(18)15(8-10)26(22,23)24)4-1-9-2-5-12(17)14(7-9)25(19,20)21/h1-8,17-18H,(H,19,20,21)(H,22,23,24)/b4-1+ |
| InChIKey | LWGWURJYLRYTJV-DAFODLJHSA-N |
| XLogP | 1.49 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|