C27H32FN3O2 — CID 169080029
12-[4-(4-fluorophenyl)-4-oxobutyl]-2,2,4,10-tetramethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 169080029) has the molecular formula C27H32FN3O2 and a molecular weight of 449.57 g/mol. Its IUPAC name is 12-[4-(4-fluorophenyl)-4-oxobutyl]-2,2,4,10-tetramethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | 12-[4-(4-fluorophenyl)-4-oxobutyl]-2,2,4,10-tetramethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 169080029 |
| Molecular Formula | C27H32FN3O2 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 12-[4-(4-fluorophenyl)-4-oxobutyl]-2,2,4,10-tetramethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CN1C(=O)C(C)(C)N2c3c1cccc3C1(C)CN(CCCC(=O)c3ccc(F)cc3)CCC21 |
| InChI | InChI=1S/C27H32FN3O2/c1-26(2)25(33)29(4)21-8-5-7-20-24(21)31(26)23-14-16-30(17-27(20,23)3)15-6-9-22(32)18-10-12-19(28)13-11-18/h5,7-8,10-13,23H,6,9,14-17H2,1-4H3 |
| InChIKey | HWSNOHKXHZEFNL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |