C30H37N5O6Si — CID 169080557
2-amino-9-[(2R,3R,4S,5R)-3-benzoyl-2-benzyl-4-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 169080557) has the molecular formula C30H37N5O6Si and a molecular weight of 591.74 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3-benzoyl-2-benzyl-4-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3-benzoyl-2-benzyl-4-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 169080557 |
| Molecular Formula | C30H37N5O6Si |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3-benzoyl-2-benzyl-4-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(O)[C@@H](CO)O[C@@](Cc2ccccc2)(n2cnc3c(=O)[nH]c(N)nc32)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H37N5O6Si/c1-27(2,3)42(4,5)30(40)21(17-36)41-28(16-19-12-8-6-9-13-19,29(30,39)23(37)20-14-10-7-11-15-20)35-18-32-22-24(35)33-26(31)34-25(22)38/h6-15,18,21,36,39-40H,16-17H2,1-5H3,(H3,31,33,34,38)/t21-,28-,29+,30+/m1/s1 |
| InChIKey | CGTDIYJUGRPYCG-BROCHEKRSA-N |
| XLogP | 2.38 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|