C20H15F3N2O3 — CID 169080816
N-[(1R,5R,6R)-5-(difluoromethyl)-5-(2-fluoro-5-formylphenyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide (PubChem CID 169080816) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-[(1R,5R,6R)-5-(difluoromethyl)-5-(2-fluoro-5-formylphenyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide.
| Compound Name | N-[(1R,5R,6R)-5-(difluoromethyl)-5-(2-fluoro-5-formylphenyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide |
|---|---|
| PubChem CID | 169080816 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(1R,5R,6R)-5-(difluoromethyl)-5-(2-fluoro-5-formylphenyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide |
| SMILES | O=Cc1ccc(F)c([C@]2(C(F)F)N=C(NC(=O)c3ccccc3)O[C@@H]3C[C@@H]32)c1 |
| InChI | InChI=1S/C20H15F3N2O3/c21-15-7-6-11(10-26)8-13(15)20(18(22)23)14-9-16(14)28-19(25-20)24-17(27)12-4-2-1-3-5-12/h1-8,10,14,16,18H,9H2,(H,24,25,27)/t14-,16+,20-/m0/s1 |
| InChIKey | DKBQEXYUAPCBPH-NBQZKYEYSA-N |
| XLogP | 3.30 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|