C15H21Cl3N4O2 — CID 169081133
7-chloro-4-[(2R,4R,5R)-2,5-dimethylpiperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride (PubChem CID 169081133) has the molecular formula C15H21Cl3N4O2 and a molecular weight of 395.72 g/mol. Its IUPAC name is 7-chloro-4-[(2R,4R,5R)-2,5-dimethylpiperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride.
| Compound Name | 7-chloro-4-[(2R,4R,5R)-2,5-dimethylpiperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 169081133 |
| Molecular Formula | C15H21Cl3N4O2 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 7-chloro-4-[(2R,4R,5R)-2,5-dimethylpiperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride |
| SMILES | C[C@@H]1C[C@@H](n2c(=O)c(=O)n(C)c3cc(Cl)cnc32)[C@H](C)CN1.Cl.Cl |
| InChI | InChI=1S/C15H19ClN4O2.2ClH/c1-8-6-17-9(2)4-11(8)20-13-12(5-10(16)7-18-13)19(3)14(21)15(20)22;;/h5,7-9,11,17H,4,6H2,1-3H3;2*1H/t8-,9-,11-;;/m1../s1 |
| InChIKey | YMHLYCHVXOEOQW-CUZZJZPZSA-N |
| XLogP | 2.15 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|