About (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate
(2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate (PubChem CID 169081240) has the molecular formula C11H9Cl3N4O4
and a molecular weight of 367.58 g/mol. Its IUPAC name is (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate.
Molecular Properties
| Compound Name | (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate |
| PubChem CID | 169081240 |
| Molecular Formula | C11H9Cl3N4O4 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate |
| SMILES | [N-]=[N+]=Nc1ccc(CC(=O)ONC(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H9Cl3N4O4/c12-11(13,14)6-21-10(20)17-22-9(19)5-7-1-3-8(4-2-7)16-18-15/h1-4H,5-6H2,(H,17,20) |
| InChIKey | NCNDDWVUSRLFPI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate?
The IUPAC name of (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate (CID 169081240) is (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate.
What is the SMILES notation for (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate?
The canonical SMILES for (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate is [N-]=[N+]=Nc1ccc(CC(=O)ONC(=O)OCC(Cl)(Cl)Cl)cc1.
What is the InChIKey of (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate?
The InChIKey is NCNDDWVUSRLFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl3N4O4/c12-11(13,14)6-21-10(20)17-22-9(19)5-7-1-3-8(4-2-7)16-18-15/h1-4H,5-6H2,(H,17,20).
What are the key properties of (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate?
(2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate has a molecular weight of 367.58 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trichloroethoxycarbonylamino) 2-(4-azidophenyl)acetate is sourced from PubChem (CID 169081240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).