C18H30N2O3Si — CID 169081409
5-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3-methylpyridine-2-carboxylic acid (PubChem CID 169081409) has the molecular formula C18H30N2O3Si and a molecular weight of 350.54 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3-methylpyridine-2-carboxylic acid.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169081409 |
| Molecular Formula | C18H30N2O3Si |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-3-methylpyridine-2-carboxylic acid |
| SMILES | Cc1cc(N2CCC(O[Si](C)(C)C(C)(C)C)CC2)cnc1C(=O)O |
| InChI | InChI=1S/C18H30N2O3Si/c1-13-11-14(12-19-16(13)17(21)22)20-9-7-15(8-10-20)23-24(5,6)18(2,3)4/h11-12,15H,7-10H2,1-6H3,(H,21,22) |
| InChIKey | UKVFQDFWEFZRKQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|